cas: 10049-42-0 — see every product listed under this CAS number, including other names
DIETHYL[3-(TRIETHOXYSILYL)PROPYL]AMINE, 97% (CAS 10049-42-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F843866-1G |
| cas | 10049-42-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 435.28 Pln | |
| Fluorochem | 10g | 445.69 Pln | |
| Fluorochem | 25g | 799.74 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
N,N-diethyl-3-triethoxysilylpropan-1-amine (CAS 10049-42-0) is a chemical compound with the molecular formula C13H31NO3Si and a molecular weight of 277.48 g/mol. IUPAC name: N,N-diethyl-3-triethoxysilylpropan-1-amine. InChIKey: BVBBZEKOMUDXMZ-UHFFFAOYSA-N.
| Molecular formula | C13H31NO3Si |
|---|---|
| Molecular weight | 277.48 g/mol |
| IUPAC name | N,N-diethyl-3-triethoxysilylpropan-1-amine |
| InChIKey | BVBBZEKOMUDXMZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCC[Si](OCC)(OCC)OCC |
Computed by PubChem (NCBI)