CAS 174267-71-1 appears in our catalog under these names: 12-Oxa-3,6,9-triazatetradecanoic acid, 6-(carboxymethyl)-3,9-bis[2-(1,1-dimethylethoxy)-2-oxoethyl]-13,13-dimethyl-11-oxo-, 1-(1,1-dimethylethyl) ester, 95%, DTPA-tetra (t-Bu ester), >95% (HPLC), DTPA–tetra (t–Bu ester), 2-(Bis(2-(bis(2-(tert-butoxy)-2-oxoethyl)amino)ethyl)amino)acetic acid, 98%, 98%, DTPA-tetra (t-Bu ester), 99.63%. Offered by: Combi-blocks, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100mg, 10mg, 50mg, 25mg, 5mg.
2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]acetic acid (CAS 174267-71-1) is a chemical compound with the molecular formula C30H55N3O10 and a molecular weight of 617.8 g/mol. IUPAC name: 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]acetic acid. InChIKey: YOAXKQZNUYOPFL-UHFFFAOYSA-N.
| Molecular formula | C30H55N3O10 |
|---|---|
| Molecular weight | 617.8 g/mol |
| IUPAC name | 2-[bis[2-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| InChIKey | YOAXKQZNUYOPFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN(CCN(CCN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C)CC(=O)O)CC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)