DW71177
cas: 2241311-72-6 — see every product listed under this CAS number, including other names
DW71177 (CAS 2241311-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: TargetMol, GLPBio, Chemat.
| brand | TargetMol |
|---|---|
| catalog number | T85333-1mg |
| cas | 2241311-72-6 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 1428.68 Pln | |
| TargetMol | 5mg | 3241.52 Pln | |
| TargetMol | 10mg | 4563.00 Pln | |
| TargetMol | 25mg | 7013.65 Pln | |
| TargetMol | 50mg | 9596.79 Pln | |
| GLPBio | 1mg | 1256.99 Pln | |
| GLPBio | 10mg | 3218.12 Pln | |
| GLPBio | 5mg | 2286.70 Pln | |
| Chemat | 1mg | 194.00 Pln | |
| Chemat | 5mg | 390.80 Pln | |
| Chemat | 10mg | 582.80 Pln | |
| Chemat | 25mg | 866.00 Pln | |
| Chemat | 50mg | 1437.20 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide (CAS 2241311-72-6) is a chemical compound with the molecular formula C20H28N6O2 and a molecular weight of 384.5 g/mol. IUPAC name: N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide. InChIKey: NAPOLFVZKFHOBG-UHFFFAOYSA-N.
| Molecular formula | C20H28N6O2 |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide |
| InChIKey | NAPOLFVZKFHOBG-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)OC)N=C2NCCCCNC(=O)CC(C)C |
Computed by PubChem (NCBI)
Synonyms:
orb2308708