cas: 85939-49-7 — see every product listed under this CAS number, including other names
DWM39497 95% (CAS 85939-49-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1000564-100mg |
| cas | 85939-49-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 642.94 Pln | |
| Ambeed | 250mg | 1221.44 Pln | |
| Ambeed | 1g | 4030.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1000564 |
Manganese(3+);5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin-22,24-diide;chloride (CAS 85939-49-7) is a chemical compound with the molecular formula C56H52ClMnN4 and a molecular weight of 871.4 g/mol. IUPAC name: manganese(3+);5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin-22,24-diide;chloride. InChIKey: DJRQGDJTRUAUPG-UHFFFAOYSA-M.
| Molecular formula | C56H52ClMnN4 |
|---|---|
| Molecular weight | 871.4 g/mol |
| IUPAC name | manganese(3+);5,10,15,20-tetrakis(2,4,6-trimethylphenyl)porphyrin-22,24-diide;chloride |
| InChIKey | DJRQGDJTRUAUPG-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C([N-]5)C(=C6C=CC2=N6)C7=C(C=C(C=C7C)C)C)C8=C(C=C(C=C8C)C)C)C=C4)C9=C(C=C(C=C9C)C)C)[N-]3)C.[Cl-].[Mn+3] |
Computed by PubChem (NCBI)