cas: 34523-28-9 — see every product listed under this CAS number, including other names
Dansyl Fluoride, >98.0%(HPLC)(T) (CAS 34523-28-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2197-1G |
| cas | 34523-28-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 464.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
5-(dimethylamino)naphthalene-1-sulfonyl fluoride (CAS 34523-28-9) is a chemical compound with the molecular formula C12H12FNO2S and a molecular weight of 253.29 g/mol. IUPAC name: 5-(dimethylamino)naphthalene-1-sulfonyl fluoride. InChIKey: JMHHECQPPFEVMU-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO2S |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 5-(dimethylamino)naphthalene-1-sulfonyl fluoride |
| InChIKey | JMHHECQPPFEVMU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)F |
Computed by PubChem (NCBI)