cas: 1104-36-5 — see every product listed under this CAS number, including other names
Dansyl-L-phenylalanine, 98%, 98% (CAS 1104-36-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114P9M-100mg |
| cas | 1104-36-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 568.40 Pln | |
| Chemat | 5g | 2123.60 Pln | |
| Chemat | 10g | 3477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoic acid (CAS 1104-36-5) is a chemical compound with the molecular formula C21H22N2O4S and a molecular weight of 398.5 g/mol. IUPAC name: (2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoic acid. InChIKey: GPIOGTIFRDHWSB-SFHVURJKSA-N.
| Molecular formula | C21H22N2O4S |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | GPIOGTIFRDHWSB-SFHVURJKSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N[C@@H](CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)