cas: 461432-25-7 — see every product listed under this CAS number, including other names
Dapagliflozin Tetraacetate 98% (CAS 461432-25-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A572964-500g |
| cas | 461432-25-7 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 12641.25 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 10g | 648.50 Pln | |
| Ambeed | 25g | 1221.44 Pln | |
| Ambeed | 100g | 3212.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A572964 |
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate (CAS 461432-25-7) is a chemical compound with the molecular formula C29H33ClO10 and a molecular weight of 577.0 g/mol. IUPAC name: [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate. InChIKey: DKOQYKRDCDCNOR-ZCCUTQAASA-N.
| Molecular formula | C29H33ClO10 |
|---|---|
| Molecular weight | 577.0 g/mol |
| IUPAC name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate |
| InChIKey | DKOQYKRDCDCNOR-ZCCUTQAASA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)Cl |
Computed by PubChem (NCBI)