cas: 2182601-68-7 — see every product listed under this CAS number, including other names
Dbco-peg4-dbco, 95%, 95% (CAS 2182601-68-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120EFH-25mg |
| cas | 2182601-68-7 |
| size | 25mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 501.20 Pln | |
| Chemat | 50mg | 832.40 Pln | |
| Chemat | 100mg | 1206.80 Pln | |
| Chemat | 250mg | 2085.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-3-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanamide (CAS 2182601-68-7) is a chemical compound with the molecular formula C48H50N4O8 and a molecular weight of 810.9 g/mol. IUPAC name: N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-3-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanamide. InChIKey: YCDMQCKYINAWGI-UHFFFAOYSA-N.
| Molecular formula | C48H50N4O8 |
|---|---|
| Molecular weight | 810.9 g/mol |
| IUPAC name | N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-3-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanamide |
| InChIKey | YCDMQCKYINAWGI-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)CCOCCOCCOCCOCCC(=O)NCCC(=O)N4CC5=CC=CC=C5C#CC6=CC=CC=C64 |
Computed by PubChem (NCBI)