cas: 681492-22-8 — see every product listed under this CAS number, including other names
Delamanid 95% (CAS 681492-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A493940-1mg |
| cas | 681492-22-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 147.88 Pln | |
| Ambeed | 5mg | 259.12 Pln | |
| Ambeed | 10mg | 359.25 Pln | |
| Ambeed | 25mg | 526.12 Pln | |
| Ambeed | 50mg | 720.81 Pln | |
| Ambeed | 100mg | 1093.50 Pln | |
| Ambeed | 250mg | 1616.38 Pln | |
| Ambeed | 1g | 3162.75 Pln | |
| Ambeed | 5g | 11567.69 Pln | |
| Ambeed | 10g | 18465.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A493940 |
Delamanid is a member of piperidines.
Source: ChEBI
| Molecular formula | C25H25F3N4O6 |
|---|---|
| Molecular weight | 534.5 g/mol |
| IUPAC name | (2R)-2-methyl-6-nitro-2-[[4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]phenoxy]methyl]-3H-imidazo[2,1-b][1,3]oxazole |
| InChIKey | XDAOLTSRNUSPPH-XMMPIXPASA-N |
| SMILES | C[C@@]1(CN2C=C(N=C2O1)[N+](=O)[O-])COC3=CC=C(C=C3)N4CCC(CC4)OC5=CC=C(C=C5)OC(F)(F)F |
Computed by PubChem (NCBI)