cas: 1951424-89-7 — see every product listed under this CAS number, including other names
Desthiobiotin-PEG4-propargyl (CAS 1951424-89-7) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T39364-2mg |
| cas | 1951424-89-7 |
| size | 2mg |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 2mg | 399.00 Pln | |
| TargetMol | 5mg | 499.07 Pln | |
| TargetMol | 10mg | 638.26 Pln | |
| TargetMol | 25mg | 910.49 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 26 days |
6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide (CAS 1951424-89-7) is a chemical compound with the molecular formula C21H37N3O6 and a molecular weight of 427.5 g/mol. IUPAC name: 6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide. InChIKey: CQSNBVBVAYQBHF-RBUKOAKNSA-N.
| Molecular formula | C21H37N3O6 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 6-[(4R,5S)-5-methyl-2-oxoimidazolidin-4-yl]-N-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]hexanamide |
| InChIKey | CQSNBVBVAYQBHF-RBUKOAKNSA-N |
| SMILES | C[C@H]1[C@H](NC(=O)N1)CCCCCC(=O)NCCOCCOCCOCCOCC#C |
Computed by PubChem (NCBI)