Di-tert-butyl 3,6-bis(5-bromothiophen-2-yl)-1,4-dioxopyrrolo[3,4-c]pyrrole-2,5(1H,4H)-dicarboxylate, 97%
cas: 1046864-84-9 — see every product listed under this CAS number, including other names
Di-tert-butyl 3,6-bis(5-bromothiophen-2-yl)-1,4-dioxopyrrolo[3,4-c]pyrrole-2,5(1H,4H)-dicarboxylate, 97% (CAS 1046864-84-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A963557-250mg |
| cas | 1046864-84-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1627.50 Pln | |
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 717.20 Pln | |
| BLDpharm | 100mg | 403.22 Pln | |
| BLDpharm | 250mg | 636.47 Pln | |
| BLDpharm | 1g | 1591.69 Pln | |
| Fluorochem | 100mg | 633.13 Pln | |
| Fluorochem | 250mg | 1325.59 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Ditert-butyl 1,4-bis(5-bromothiophen-2-yl)-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate (CAS 1046864-84-9) is a chemical compound with the molecular formula C24H22Br2N2O6S2 and a molecular weight of 658.4 g/mol. IUPAC name: ditert-butyl 1,4-bis(5-bromothiophen-2-yl)-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate. InChIKey: QOZQIPYHXMJDFH-UHFFFAOYSA-N.
| Molecular formula | C24H22Br2N2O6S2 |
|---|---|
| Molecular weight | 658.4 g/mol |
| IUPAC name | ditert-butyl 1,4-bis(5-bromothiophen-2-yl)-3,6-dioxopyrrolo[3,4-c]pyrrole-2,5-dicarboxylate |
| InChIKey | QOZQIPYHXMJDFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C(=C2C(=C(N(C2=O)C(=O)OC(C)(C)C)C3=CC=C(S3)Br)C1=O)C4=CC=C(S4)Br |
Computed by PubChem (NCBI)
Synonyms:
C24H22Br2N2O6S2