cas: 870703-61-0 — see every product listed under this CAS number, including other names
Di-tert-butyl 6-bromopyridin-2-ylimidodicarbonate, 96%, 96% (CAS 870703-61-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MZU-250mg |
| cas | 870703-61-0 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 530.00 Pln | |
| Chemat | 10g | 885.20 Pln | |
| Chemat | 25g | 1706.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(6-bromo-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 870703-61-0) is a chemical compound with the molecular formula C15H21BrN2O4 and a molecular weight of 373.24 g/mol. IUPAC name: tert-butyl N-(6-bromo-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: MRXCEYKGPXZUBZ-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2O4 |
|---|---|
| Molecular weight | 373.24 g/mol |
| IUPAC name | tert-butyl N-(6-bromo-2-pyridinyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | MRXCEYKGPXZUBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=NC(=CC=C1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)