cas: 137348-86-8 — see every product listed under this CAS number, including other names
Di-tert-butyl diisopropylphosphoramidite, 95% (CAS 137348-86-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 100g, 500g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F226515-1G |
| cas | 137348-86-8 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 195.78 Pln | |
| Fluorochem | 15g | 247.85 Pln | |
| Fluorochem | 25g | 357.18 Pln | |
| Fluorochem | 100g | 1153.78 Pln | |
| Fluorochem | 500g | 5261.71 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1126.88 Pln | |
| Ambeed | 500g | 5354.38 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
N-[bis[(2-methylpropan-2-yl)oxy]phosphanyl]-N-propan-2-ylpropan-2-amine (CAS 137348-86-8) is a chemical compound with the molecular formula C14H32NO2P and a molecular weight of 277.38 g/mol. IUPAC name: N-[bis[(2-methylpropan-2-yl)oxy]phosphanyl]-N-propan-2-ylpropan-2-amine. InChIKey: YGFLCNPXEPDANQ-UHFFFAOYSA-N.
| Molecular formula | C14H32NO2P |
|---|---|
| Molecular weight | 277.38 g/mol |
| IUPAC name | N-[bis[(2-methylpropan-2-yl)oxy]phosphanyl]-N-propan-2-ylpropan-2-amine |
| InChIKey | YGFLCNPXEPDANQ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)P(OC(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)