Diazo Biotin-PEG3-alkyne, 95%, 95%
cas: 1884349-58-9 — see every product listed under this CAS number, including other names
Diazo Biotin-PEG3-alkyne, 95%, 95% (CAS 1884349-58-9) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120E2J-5mg |
| cas | 1884349-58-9 |
| size | 5mg |
| availability | 0.05g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 1595.60 Pln | |
| Chemat | 10mg | 2258.00 Pln | |
| Chemat | 25mg | 3390.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]-4-[[2-hydroxy-5-[2-(3-prop-2-ynoxypropanoylamino)ethyl]phenyl]diazenyl]benzamide (CAS 1884349-58-9) is a chemical compound with the molecular formula C39H53N7O9S and a molecular weight of 795.9 g/mol. IUPAC name: N-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]-4-[[2-hydroxy-5-[2-(3-prop-2-ynoxypropanoylamino)ethyl]phenyl]diazenyl]benzamide. InChIKey: AIUZFZDETVBCLH-OHTDSXDOSA-N.
| Molecular formula | C39H53N7O9S |
|---|---|
| Molecular weight | 795.9 g/mol |
| IUPAC name | N-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethyl]-4-[[2-hydroxy-5-[2-(3-prop-2-ynoxypropanoylamino)ethyl]phenyl]diazenyl]benzamide |
| InChIKey | AIUZFZDETVBCLH-OHTDSXDOSA-N |
| SMILES | C#CCOCCC(=O)NCCC1=CC(=C(C=C1)O)N=NC2=CC=C(C=C2)C(=O)NCCOCCOCCOCCNC(=O)CCCC[C@H]3[C@@H]4[C@H](CS3)NC(=O)N4 |
Computed by PubChem (NCBI)