cas: 29451-76-1 — see every product listed under this CAS number, including other names
Dibenzo[b,d]thiophen-1-amine 98% (CAS 29451-76-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1486394-250mg |
| cas | 29451-76-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1099.06 Pln | |
| Ambeed | 5g | 3813.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1486394 |
Dibenzothiophen-1-amine (CAS 29451-76-1) is a chemical compound with the molecular formula C12H9NS and a molecular weight of 199.27 g/mol. IUPAC name: dibenzothiophen-1-amine. InChIKey: LUOGSASRTYIOCL-UHFFFAOYSA-N.
| Molecular formula | C12H9NS |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | dibenzothiophen-1-amine |
| InChIKey | LUOGSASRTYIOCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C=CC=C3S2)N |
Computed by PubChem (NCBI)