cas: 1566649-44-2 — see every product listed under this CAS number, including other names
Dibenzyl bicyclo[1.1.1]pentane-1,3-diyldicarbamate, 97%, 97% (CAS 1566649-44-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OVP-250mg |
| cas | 1566649-44-2 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 602.00 Pln | |
| Chemat | 500mg | 1134.80 Pln | |
| Chemat | 1g | 1667.60 Pln | |
| Chemat | 5g | 4874.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-[3-(phenylmethoxycarbonylamino)-1-bicyclo[1.1.1]pentanyl]carbamate (CAS 1566649-44-2) is a chemical compound with the molecular formula C21H22N2O4 and a molecular weight of 366.4 g/mol. IUPAC name: benzyl N-[3-(phenylmethoxycarbonylamino)-1-bicyclo[1.1.1]pentanyl]carbamate. InChIKey: KEHKSWQXSDXEPB-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | benzyl N-[3-(phenylmethoxycarbonylamino)-1-bicyclo[1.1.1]pentanyl]carbamate |
| InChIKey | KEHKSWQXSDXEPB-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)NC(=O)OCC3=CC=CC=C3)NC(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)