CAS 14783-09-6 appears in our catalog under these names: Dichloro(1,10-phenanthroline)copper(II), >98.0%(N)(T), DICHLORO(1,10-PHENANTHROLINE)COPPER(II),, Dichloro(1,10-phenanthroline)copper, 97%, 97%, Dichloro(1,10-phenanthroline)copper, 97%. Offered by: TCI, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 50g, 100g.
Dichlorocopper;1,10-phenanthroline (CAS 14783-09-6) is a chemical compound with the molecular formula C12H8Cl2CuN2 and a molecular weight of 314.65 g/mol. IUPAC name: dichlorocopper;1,10-phenanthroline. InChIKey: PHECBGBJCLDCMF-UHFFFAOYSA-L.
| Molecular formula | C12H8Cl2CuN2 |
|---|---|
| Molecular weight | 314.65 g/mol |
| IUPAC name | dichlorocopper;1,10-phenanthroline |
| InChIKey | PHECBGBJCLDCMF-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.Cl[Cu]Cl |
Computed by PubChem (NCBI)