CAS 1034901-50-2 appears in our catalog under these names: [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine]nickel(II) Dichloride, >95.0%(T), Dichloro(4,4′-di-tert-butyl-2,2′-bipyridine)nickel, 97%, NiCl?(dtbbpy), 97%. Offered by: TCI, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 15g, 25g, 100g.
4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dichloronickel (CAS 1034901-50-2) is a chemical compound with the molecular formula C18H24Cl2N2Ni and a molecular weight of 398.0 g/mol. IUPAC name: 4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dichloronickel. InChIKey: PCWIKFRTCXESOT-UHFFFAOYSA-L.
| Molecular formula | C18H24Cl2N2Ni |
|---|---|
| Molecular weight | 398.0 g/mol |
| IUPAC name | 4-tert-butyl-2-(4-tert-butyl-2-pyridinyl)pyridine;dichloronickel |
| InChIKey | PCWIKFRTCXESOT-UHFFFAOYSA-L |
| SMILES | CC(C)(C)C1=CC(=NC=C1)C2=NC=CC(=C2)C(C)(C)C.Cl[Ni]Cl |
Computed by PubChem (NCBI)