CAS 2320-96-9 appears in our catalog under these names: 4,5–Dichlorofluorescein, DICHLOROFLUORESCEIN, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 5g, 50g.
4',5'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 2320-96-9) is a chemical compound with the molecular formula C20H10Cl2O5 and a molecular weight of 401.2 g/mol. IUPAC name: 4',5'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: WLHLYHWMNUCWEV-UHFFFAOYSA-N.
| Molecular formula | C20H10Cl2O5 |
|---|---|
| Molecular weight | 401.2 g/mol |
| IUPAC name | 4',5'-dichloro-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | WLHLYHWMNUCWEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Cl)OC5=C3C=CC(=C5Cl)O |
Computed by PubChem (NCBI)