cas: 15307-79-6 — see every product listed under this CAS number, including other names
Diclofenac (Sodium), 98% (CAS 15307-79-6) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F986624-500MG |
| cas | 15307-79-6 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 346.77 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 414.46 Pln | |
| Fluorochem | 100g | 445.69 Pln | |
| Fluorochem | 500g | 1060.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Diclofenac sodium is the sodium salt of diclofenac. It contains a diclofenac(1-).
Source: ChEBI
| Molecular formula | C14H10Cl2NNaO2 |
|---|---|
| Molecular weight | 318.1 g/mol |
| IUPAC name | sodium 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| InChIKey | KPHWPUGNDIVLNH-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[Na+] |
Computed by PubChem (NCBI)