Dicyclohexyl(mesityl)phosphine, 98%
cas: 870703-48-3 — see every product listed under this CAS number, including other names
Dicyclohexyl(mesityl)phosphine, 98% (CAS 870703-48-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A810559-25mg |
| cas | 870703-48-3 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 492.75 Pln | |
| Ambeed | 50mg | 782.00 Pln | |
| Ambeed | 100mg | 1282.62 Pln | |
| Ambeed | 250mg | 2250.50 Pln | |
| Ambeed | 1g | 5949.56 Pln | |
| Chemat | 25mg | 558.80 Pln | |
| Chemat | 50mg | 909.20 Pln | |
| Chemat | 100mg | 1499.60 Pln | |
| Chemat | 250mg | 2646.80 Pln | |
| Chemat | 1g | 7043.60 Pln | |
| BLDpharm | 25mg | 525.40 Pln | |
| BLDpharm | 50mg | 841.95 Pln | |
| BLDpharm | 100mg | 1375.10 Pln | |
| BLDpharm | 250mg | 2419.17 Pln | |
| BLDpharm | 1g | 6406.66 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Dicyclohexyl-(2,4,6-trimethylphenyl)phosphane (CAS 870703-48-3) is a chemical compound with the molecular formula C21H33P and a molecular weight of 316.5 g/mol. IUPAC name: dicyclohexyl-(2,4,6-trimethylphenyl)phosphane. InChIKey: FZMRUTAFFILQPI-UHFFFAOYSA-N.
| Molecular formula | C21H33P |
|---|---|
| Molecular weight | 316.5 g/mol |
| IUPAC name | dicyclohexyl-(2,4,6-trimethylphenyl)phosphane |
| InChIKey | FZMRUTAFFILQPI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)P(C2CCCCC2)C3CCCCC3)C |
Computed by PubChem (NCBI)