Dicyclohexylethylphosphine tetrafluoroborate, 95%
cas: 1215113-73-7 — see every product listed under this CAS number, including other names
Dicyclohexylethylphosphine tetrafluoroborate, 95% (CAS 1215113-73-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1352494-250mg |
| cas | 1215113-73-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 2495.25 Pln | |
| Ambeed | 1g | 6667.12 Pln | |
| Chemat | 50mg | 592.40 Pln | |
| Chemat | 100mg | 962.00 Pln | |
| Chemat | 250mg | 1590.80 Pln | |
| Chemat | 1g | 4182.80 Pln | |
| BLDpharm | 50mg | 1025.22 Pln | |
| BLDpharm | 100mg | 1619.45 Pln | |
| BLDpharm | 250mg | 2685.75 Pln | |
| BLDpharm | 1g | 7184.16 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Dicyclohexyl(ethyl)phosphane;hydron;tetrafluoroborate (CAS 1215113-73-7) is a chemical compound with the molecular formula C14H28BF4P and a molecular weight of 314.15 g/mol. IUPAC name: dicyclohexyl(ethyl)phosphane;hydron;tetrafluoroborate. InChIKey: FUAOOPLFSZKCMD-UHFFFAOYSA-O.
| Molecular formula | C14H28BF4P |
|---|---|
| Molecular weight | 314.15 g/mol |
| IUPAC name | dicyclohexyl(ethyl)phosphane;hydron;tetrafluoroborate |
| InChIKey | FUAOOPLFSZKCMD-UHFFFAOYSA-O |
| SMILES | [H+].[B-](F)(F)(F)F.CCP(C1CCCCC1)C2CCCCC2 |
Computed by PubChem (NCBI)