cas: 63909-50-2 — see every product listed under this CAS number, including other names
Diethyl (3-Methylbenzyl)phosphonate, 95%, 95% (CAS 63909-50-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BST-5g |
| cas | 63909-50-2 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 100g | 558.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(diethoxyphosphorylmethyl)-3-methylbenzene (CAS 63909-50-2) is a chemical compound with the molecular formula C12H19O3P and a molecular weight of 242.25 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-3-methylbenzene. InChIKey: LMLREDDVMFNSMK-UHFFFAOYSA-N.
| Molecular formula | C12H19O3P |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-3-methylbenzene |
| InChIKey | LMLREDDVMFNSMK-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC=CC(=C1)C)OCC |
Computed by PubChem (NCBI)