Diethyl 2,2-difluoropentanedioate, 95%
cas: 428-97-7 — see every product listed under this CAS number, including other names
Diethyl 2,2-difluoropentanedioate, 95% (CAS 428-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F318230-250MG |
| cas | 428-97-7 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 336.36 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 5g | 2450.20 Pln | |
| Fluorochem | 10g | 4303.71 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| Ambeed | 10g | 1544.06 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1461.20 Pln | |
| Chemat | 10g | 2584.40 Pln | |
| BLDpharm | 100mg | 208.84 Pln | |
| BLDpharm | 250mg | 292.14 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 991.90 Pln | |
| BLDpharm | 10g | 1663.88 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Diethyl 2,2-difluoropentanedioate (CAS 428-97-7) is a chemical compound with the molecular formula C9H14F2O4 and a molecular weight of 224.20 g/mol. IUPAC name: diethyl 2,2-difluoropentanedioate. InChIKey: YVPKMLFMDHSTKJ-UHFFFAOYSA-N.
| Molecular formula | C9H14F2O4 |
|---|---|
| Molecular weight | 224.20 g/mol |
| IUPAC name | diethyl 2,2-difluoropentanedioate |
| InChIKey | YVPKMLFMDHSTKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(C(=O)OCC)(F)F |
Computed by PubChem (NCBI)