CAS 2248687-66-1 is the registry number for Diethyl 2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)terephthalate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
Diethyl 2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,4-dicarboxylate (CAS 2248687-66-1) is a chemical compound with the molecular formula C24H36B2O8 and a molecular weight of 474.2 g/mol. IUPAC name: diethyl 2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,4-dicarboxylate. InChIKey: DAAIRYCAJCGGNH-UHFFFAOYSA-N.
| Molecular formula | C24H36B2O8 |
|---|---|
| Molecular weight | 474.2 g/mol |
| IUPAC name | diethyl 2,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,4-dicarboxylate |
| InChIKey | DAAIRYCAJCGGNH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C(=O)OCC)B3OC(C(O3)(C)C)(C)C)C(=O)OCC |
Computed by PubChem (NCBI)