cas: 3005-66-1 — see every product listed under this CAS number, including other names
Diethyl 2-(((benzyloxy)carbonyl)amino)malonate 98% (CAS 3005-66-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A424007-250mg |
| cas | 3005-66-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 1877.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A424007 |
Diethyl 2-(phenylmethoxycarbonylamino)propanedioate (CAS 3005-66-1) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: diethyl 2-(phenylmethoxycarbonylamino)propanedioate. InChIKey: RKUPWPSMWSKJQP-UHFFFAOYSA-N.
| Molecular formula | C15H19NO6 |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | diethyl 2-(phenylmethoxycarbonylamino)propanedioate |
| InChIKey | RKUPWPSMWSKJQP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)