cas: 62778-16-9 — see every product listed under this CAS number, including other names
Diethyl 2-methylbenzylphosphonate, 98%, 98% (CAS 62778-16-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BNU-250mg |
| cas | 62778-16-9 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 275.60 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 832.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(diethoxyphosphorylmethyl)-2-methylbenzene (CAS 62778-16-9) is a chemical compound with the molecular formula C12H19O3P and a molecular weight of 242.25 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-2-methylbenzene. InChIKey: SAVIMLRIKAZZCZ-UHFFFAOYSA-N.
| Molecular formula | C12H19O3P |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-2-methylbenzene |
| InChIKey | SAVIMLRIKAZZCZ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC=CC=C1C)OCC |
Computed by PubChem (NCBI)