cas: 173443-43-1 — see every product listed under this CAS number, including other names
Diethyl 4-iodobenzylphosphonate, 97% (CAS 173443-43-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239901-1G |
| cas | 173443-43-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 737.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(diethoxyphosphorylmethyl)-4-iodobenzene (CAS 173443-43-1) is a chemical compound with the molecular formula C11H16IO3P and a molecular weight of 354.12 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-4-iodobenzene. InChIKey: ACYSYNIYTMHNSY-UHFFFAOYSA-N.
| Molecular formula | C11H16IO3P |
|---|---|
| Molecular weight | 354.12 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-4-iodobenzene |
| InChIKey | ACYSYNIYTMHNSY-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC=C(C=C1)I)OCC |
Computed by PubChem (NCBI)