Dihydralazine sulfate 99%
cas: 7327-87-9 — see every product listed under this CAS number, including other names
Dihydralazine sulfate 99% (CAS 7327-87-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A738601-1mg |
| cas | 7327-87-9 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 203.50 Pln | |
| Ambeed | 5mg | 225.75 Pln | |
| Ambeed | 10mg | 281.38 Pln | |
| Ambeed | 25mg | 437.12 Pln | |
| Ambeed | 50mg | 626.25 Pln | |
| Ambeed | 100mg | 759.75 Pln | |
| Ambeed | 250mg | 1794.38 Pln | |
| Ambeed | 1g | 5793.81 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A738601 |
(4-hydrazinylphthalazin-1-yl)hydrazine;sulfuric acid (CAS 7327-87-9) is a chemical compound with the molecular formula C8H12N6O4S and a molecular weight of 288.29 g/mol. IUPAC name: (4-hydrazinylphthalazin-1-yl)hydrazine;sulfuric acid. InChIKey: BWHAMWGGORIDBK-UHFFFAOYSA-N.
| Molecular formula | C8H12N6O4S |
|---|---|
| Molecular weight | 288.29 g/mol |
| IUPAC name | (4-hydrazinylphthalazin-1-yl)hydrazine;sulfuric acid |
| InChIKey | BWHAMWGGORIDBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN=C2NN)NN.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Dihydralazine sulfate, Dihydralazine sulphate, Depressan, 1,4-Dihydrazinophthalazine sulfate, Sulfate, Dihydralazine, 1,4-Dihydrazinylphthalazine Sulfate, Ophthazin Sulfate, 1,4-Dihydrazinophthalazine hydrogen sulfate, Dihydralazinsulfat, (4-hydrazinylphthalazin-1-yl)hydrazine;sulfuric acid