CAS 33146-99-5 appears in our catalog under these names: Dimethyl 1–methyl–1H–pyrazole–3,5–dicarboxylate, 1-Methyl-1H-pyrazole-3,5-dicarboxylic aciddimethyl ester, Dimethyl 1-methyl-1H-pyrazole-3,5-dicarboxylate, 97%, 97%, 1-Methyl-1H-pyrazole-3,5-dicarboxylic aciddimethyl ester, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 250mg, 10g, 25g, 100g, 100mg.
Dimethyl 1-methylpyrazole-3,5-dicarboxylate (CAS 33146-99-5) is a chemical compound with the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. IUPAC name: dimethyl 1-methylpyrazole-3,5-dicarboxylate. InChIKey: WGTJNBANTMXQHD-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4 |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | dimethyl 1-methylpyrazole-3,5-dicarboxylate |
| InChIKey | WGTJNBANTMXQHD-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)