cas: 147124-32-1 — see every product listed under this CAS number, including other names
Dimethyl 2-(4-chloro-2-nitrophenyl)malonate 98% (CAS 147124-32-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A976953-1g |
| cas | 147124-32-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A976953 |
Dimethyl 2-(4-chloro-2-nitrophenyl)propanedioate (CAS 147124-32-1) is a chemical compound with the molecular formula C11H10ClNO6 and a molecular weight of 287.65 g/mol. IUPAC name: dimethyl 2-(4-chloro-2-nitrophenyl)propanedioate. InChIKey: XNQGJNNDVKLNQO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO6 |
|---|---|
| Molecular weight | 287.65 g/mol |
| IUPAC name | dimethyl 2-(4-chloro-2-nitrophenyl)propanedioate |
| InChIKey | XNQGJNNDVKLNQO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)Cl)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)