cas: 1245563-09-0 — see every product listed under this CAS number, including other names
Dimethyl 2-(5-bromo-3-nitropyridin-2-yl)malonate, 95%, 95% (CAS 1245563-09-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111M7O-10g |
| cas | 1245563-09-0 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl 2-(5-bromo-3-nitro-2-pyridinyl)propanedioate (CAS 1245563-09-0) is a chemical compound with the molecular formula C10H9BrN2O6 and a molecular weight of 333.09 g/mol. IUPAC name: dimethyl 2-(5-bromo-3-nitro-2-pyridinyl)propanedioate. InChIKey: HIDYAPIMWAPXGK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O6 |
|---|---|
| Molecular weight | 333.09 g/mol |
| IUPAC name | dimethyl 2-(5-bromo-3-nitro-2-pyridinyl)propanedioate |
| InChIKey | HIDYAPIMWAPXGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=N1)Br)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)