Dimethyl 5-(tert-butyl)-2-iodoisophthalate, 97%
cas: 2682112-89-4 — see every product listed under this CAS number, including other names
Dimethyl 5-(tert-butyl)-2-iodoisophthalate, 97% (CAS 2682112-89-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1359357-250mg |
| cas | 2682112-89-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 737.50 Pln | |
| Ambeed | 5g | 2422.94 Pln | |
| Ambeed | 10g | 3897.00 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 786.41 Pln | |
| BLDpharm | 5g | 2608.00 Pln | |
| BLDpharm | 10g | 4196.32 Pln | |
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 371.60 Pln | |
| Chemat | 1g | 899.60 Pln | |
| Chemat | 5g | 2978.00 Pln | |
| Fluorochem | 5g | 2497.05 Pln | |
| Fluorochem | 250mg | 310.32 Pln | |
| Fluorochem | 1g | 737.26 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Dimethyl 5-tert-butyl-2-iodobenzene-1,3-dicarboxylate (CAS 2682112-89-4) is a chemical compound with the molecular formula C14H17IO4 and a molecular weight of 376.19 g/mol. IUPAC name: dimethyl 5-tert-butyl-2-iodobenzene-1,3-dicarboxylate. InChIKey: IACVYVJLBBFMJO-UHFFFAOYSA-N.
| Molecular formula | C14H17IO4 |
|---|---|
| Molecular weight | 376.19 g/mol |
| IUPAC name | dimethyl 5-tert-butyl-2-iodobenzene-1,3-dicarboxylate |
| InChIKey | IACVYVJLBBFMJO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(=O)OC)I)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Dimethyl 5-(tert-butyl)-2-iodoisophthalate, 1,3-Dimethyl 5-(1,1-dimethylethyl)-2-iodo-1,3-benzenedicarboxylate, dimethyl 5-tert-butyl-2-iodobenzene-1,3-dicarboxylate, dimethyl 5-tert-butyl-2-iodo-benzene-1,3-dicarboxylate, 1,3-Benzenedicarboxylic acid, 5-(1,1-dimethylethyl)-2-iodo-, 1,3-dimethyl ester