CAS 7646-75-5 appears in our catalog under these names: Dimethylphenylsilanol sodium salt, 95%, Dimethylphenylsilanol sodium salt, 97% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
Sodium dimethyl-oxido-phenylsilane (CAS 7646-75-5) is a chemical compound with the molecular formula C8H11NaOSi and a molecular weight of 174.25 g/mol. IUPAC name: sodium dimethyl-oxido-phenylsilane. InChIKey: NPZJKOMUCXNLBN-UHFFFAOYSA-N.
| Molecular formula | C8H11NaOSi |
|---|---|
| Molecular weight | 174.25 g/mol |
| IUPAC name | sodium dimethyl-oxido-phenylsilane |
| InChIKey | NPZJKOMUCXNLBN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1=CC=CC=C1)[O-].[Na+] |
Computed by PubChem (NCBI)