cas: 518-67-2 — see every product listed under this CAS number, including other names
Dimidium bromide, 98%, 98% (CAS 518-67-2) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PNO-50g |
| cas | 518-67-2 |
| size | 50g |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 5958.80 Pln | |
| Chemat | 100g | 9650.00 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1317.20 Pln | |
| Chemat | 10g | 2306.00 Pln | |
| Chemat | 25g | 4998.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide (CAS 518-67-2) is a chemical compound with the molecular formula C20H18BrN3 and a molecular weight of 380.3 g/mol. IUPAC name: 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide. InChIKey: MQOKYEROIFEEBH-UHFFFAOYSA-N.
| Molecular formula | C20H18BrN3 |
|---|---|
| Molecular weight | 380.3 g/mol |
| IUPAC name | 5-methyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide |
| InChIKey | MQOKYEROIFEEBH-UHFFFAOYSA-N |
| SMILES | C[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[Br-] |
Computed by PubChem (NCBI)