Dinaphtho[2,3-a:2',3'-h]phenazine-5,9,14,18(6H,15H)-tetraone, 98%
cas: 81-77-6 — see every product listed under this CAS number, including other names
Dinaphtho[2,3-a:2',3'-h]phenazine-5,9,14,18(6H,15H)-tetraone, 98% (CAS 81-77-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 15g, 25g, 50g, 75g, 100g, 200g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch119LIM-5g |
| cas | 81-77-6 |
| size | 5g |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 15g | 122.00 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 50g | 179.60 Pln | |
| Chemat | 75g | 242.00 Pln | |
| Chemat | 100g | 275.60 Pln | |
| Chemat | 200g | 472.40 Pln | |
| Chemat | 300g | 674.00 Pln | |
| Chemat | 400g | 866.00 Pln | |
| Fluorochem | 5g | 117.68 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 492.55 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-5,12,20,27-tetrone (CAS 81-77-6) is a chemical compound with the molecular formula C28H14N2O4 and a molecular weight of 442.4 g/mol. IUPAC name: 2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-5,12,20,27-tetrone. InChIKey: UHOKSCJSTAHBSO-UHFFFAOYSA-N.
| Molecular formula | C28H14N2O4 |
|---|---|
| Molecular weight | 442.4 g/mol |
| IUPAC name | 2,17-diazaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1(18),3(16),4(13),6,8,10,14,19(28),21,23,25,29-dodecaene-5,12,20,27-tetrone |
| InChIKey | UHOKSCJSTAHBSO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C4=C(C=C3)NC5=C(N4)C=CC6=C5C(=O)C7=CC=CC=C7C6=O |
Computed by PubChem (NCBI)