Dioxane-D8 99 atom % D
cas: 17647-74-4 — see every product listed under this CAS number, including other names
Dioxane-D8 99 atom % D (CAS 17647-74-4) is a chemical reagent available from Chemat. Available pack sizes: 0,75ml, 5ml. Offered by: Deutero.
| brand | Deutero |
|---|---|
| catalog number | 02402-075ml |
| cas | 17647-74-4 |
| size | 0,75ml |
| availability | Germany Stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Deutero | 0,75ml | 319.93 Pln | |
| Deutero | 5ml | 1951.01 Pln |
properties
| category | Rozpuszczalniki NMR |
|---|---|
| purity | 99 atom % D |
| delivery time | 1-2 weeks |
2,2,3,3,5,5,6,6-octadeuterio-1,4-dioxane (CAS 17647-74-4) is a chemical compound with the molecular formula C4H8O2 and a molecular weight of 96.15 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1,4-dioxane. InChIKey: RYHBNJHYFVUHQT-SVYQBANQSA-N.
| Molecular formula | C4H8O2 |
|---|---|
| Molecular weight | 96.15 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1,4-dioxane |
| InChIKey | RYHBNJHYFVUHQT-SVYQBANQSA-N |
| SMILES | [2H]C1(C(OC(C(O1)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)