cas: 39616-93-8 — see every product listed under this CAS number, including other names
Diphenylsulfone-3,3'-disulfonic Acid Disodium Salt, ≥97%, ≥97% (CAS 39616-93-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114PQ6-1g |
| cas | 39616-93-8 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 477.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
Disodium;3-(3-sulfonatophenyl)sulfonylbenzenesulfonate (CAS 39616-93-8) is a chemical compound with the molecular formula C12H8Na2O8S3 and a molecular weight of 422.4 g/mol. IUPAC name: disodium;3-(3-sulfonatophenyl)sulfonylbenzenesulfonate. InChIKey: GOPLREGDBGPRSC-UHFFFAOYSA-L.
| Molecular formula | C12H8Na2O8S3 |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | disodium;3-(3-sulfonatophenyl)sulfonylbenzenesulfonate |
| InChIKey | GOPLREGDBGPRSC-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)[O-])S(=O)(=O)C2=CC(=CC=C2)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)