CAS 77888-05-2 appears in our catalog under these names: Lercanidipine Impurity 2, Lercanidipine Dipropyl Ester Impurity, Nitrendipine Dipropyl Ester, >95% (HPLC), Dipropyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate, 95%, 95%, Dipropyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate, 95%. Offered by: Chemat Brand, TRC, Chemat, Ambeed. Available pack sizes: on request, 1g, 500mg, 50mg, 100mg, 250mg.
Dipropyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 77888-05-2) is a chemical compound with the molecular formula C21H26N2O6 and a molecular weight of 402.4 g/mol. IUPAC name: dipropyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: CFFRNSYMIJOXTR-UHFFFAOYSA-N.
| Molecular formula | C21H26N2O6 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | dipropyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | CFFRNSYMIJOXTR-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OCCC)C)C |
Computed by PubChem (NCBI)