Diquinoxalino[2,3-a:2',3'-c]phenazine-2,3,8,9,14,15-hexaol, 95%
cas: 677718-82-0 — see every product listed under this CAS number, including other names
Diquinoxalino[2,3-a:2',3'-c]phenazine-2,3,8,9,14,15-hexaol, 95% (CAS 677718-82-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1520200-100mg |
| cas | 677718-82-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2161.50 Pln | |
| Ambeed | 250mg | 3591.06 Pln | |
| Ambeed | 1g | 10015.75 Pln | |
| Chemat | 50mg | 1062.80 Pln | |
| Chemat | 100mg | 1763.60 Pln | |
| Chemat | 250mg | 2954.00 Pln | |
| Chemat | 1g | 10960.40 Pln | |
| BLDpharm | 50mg | 1475.06 Pln | |
| BLDpharm | 100mg | 2324.76 Pln | |
| BLDpharm | 250mg | 3863.11 Pln | |
| BLDpharm | 1g | 10799.56 Pln | |
| Fluorochem | 100mg | 2226.32 Pln | |
| Fluorochem | 250mg | 3668.52 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1,4,8,11,14,18,21,24,28-nonaene-6,7,16,17,26,27-hexone (CAS 677718-82-0) is a chemical compound with the molecular formula C24H12N6O6 and a molecular weight of 480.4 g/mol. IUPAC name: 3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1,4,8,11,14,18,21,24,28-nonaene-6,7,16,17,26,27-hexone. InChIKey: WECPGVGEYOQMFG-UHFFFAOYSA-N.
| Molecular formula | C24H12N6O6 |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | 3,10,13,20,23,30-hexazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1,4,8,11,14,18,21,24,28-nonaene-6,7,16,17,26,27-hexone |
| InChIKey | WECPGVGEYOQMFG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=O)C1=O)NC3=C4C(=C5C(=C3N2)NC6=CC(=O)C(=O)C=C6N5)NC7=CC(=O)C(=O)C=C7N4 |
Computed by PubChem (NCBI)