cas: 5799-70-2 — see every product listed under this CAS number, including other names
Disodium methanedisulfonate, 98%,RG, 98%,RG (CAS 5799-70-2) is a chemical reagent available from Chemat. Available pack sizes: 2.5kg, 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IAB8-2.5kg |
| cas | 5799-70-2 |
| size | 2.5kg |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 2.5kg | 3343.20 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 400.40 Pln | |
| Chemat | 500g | 1132.80 Pln |
| purity | 98%,RG |
|---|---|
| delivery time | 3 weeks |
Disodium;methanedisulfonate (CAS 5799-70-2) is a chemical compound with the molecular formula CH2Na2O6S2 and a molecular weight of 220.14 g/mol. IUPAC name: disodium;methanedisulfonate. InChIKey: ZZTMMVAAULUFCS-UHFFFAOYSA-L.
| Molecular formula | CH2Na2O6S2 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | disodium;methanedisulfonate |
| InChIKey | ZZTMMVAAULUFCS-UHFFFAOYSA-L |
| SMILES | C(S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)