CAS 183960-95-4 appears in our catalog under these names: Dithieno(3,2-b:2',3'-d)thiophene-2-boronic Acid, Dithieno–(3,2–b:2',3'–d)thiophene–2–boronic Acid, Dithieno(3,2-b:2',3'-d)thiophene-2-boronic Acid (contains varying amounts of Anhydride), Dithieno[3,2-b:2',3'-d]thiophen-2-ylboronic acid, 97%, 97%, Dithieno[3,2-b:2',3'-d]thiophen-2-ylboronic acid, 98%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 0,25g, 50mg, 100mg, 250mg.
3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-ylboronic acid (CAS 183960-95-4) is a chemical compound with the molecular formula C8H5BO2S3 and a molecular weight of 240.1 g/mol. IUPAC name: 3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-ylboronic acid. InChIKey: NCQLXXAFCGRZLW-UHFFFAOYSA-N.
| Molecular formula | C8H5BO2S3 |
|---|---|
| Molecular weight | 240.1 g/mol |
| IUPAC name | 3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-ylboronic acid |
| InChIKey | NCQLXXAFCGRZLW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(S1)C3=C(S2)C=CS3)(O)O |
Computed by PubChem (NCBI)