cas: 23702-54-7 — see every product listed under this CAS number, including other names
Diveratryl Ether (CAS 23702-54-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GF13981-1g |
| cas | 23702-54-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 634.48 Pln | |
| GLPBio | 5g | 1093.17 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 323.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[(3,4-dimethoxyphenyl)methoxymethyl]-1,2-dimethoxybenzene (CAS 23702-54-7) is a chemical compound with the molecular formula C18H22O5 and a molecular weight of 318.4 g/mol. IUPAC name: 4-[(3,4-dimethoxyphenyl)methoxymethyl]-1,2-dimethoxybenzene. InChIKey: KTFBMMKWTQVUIV-UHFFFAOYSA-N.
| Molecular formula | C18H22O5 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 4-[(3,4-dimethoxyphenyl)methoxymethyl]-1,2-dimethoxybenzene |
| InChIKey | KTFBMMKWTQVUIV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)COCC2=CC(=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)