Dopamine D2 receptor agonist-2
cas: 1610591-93-9 — see every product listed under this CAS number, including other names
Dopamine D2 receptor agonist-2 (CAS 1610591-93-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg. Offered by: TargetMol, Chemat, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T60075-1mg |
| cas | 1610591-93-9 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 399.00 Pln | |
| TargetMol | 5mg | 605.28 Pln | |
| TargetMol | 10mg | 778.01 Pln | |
| TargetMol | 25mg | 1149.74 Pln | |
| TargetMol | 50mg | 1594.71 Pln | |
| TargetMol | 100mg | 2285.07 Pln | |
| TargetMol | 200mg | 3201.83 Pln | |
| Chemat | 1mg | 208.40 Pln | |
| Chemat | 5mg | 366.80 Pln | |
| Chemat | 10mg | 496.40 Pln | |
| Chemat | 25mg | 774.80 Pln | |
| Chemat | 50mg | 1120.40 Pln | |
| Chemat | 100mg | 1643.60 Pln | |
| Chemat | 200mg | 2320.40 Pln | |
| MedChemExpress | 1 mg | 551.89 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 19 days |
3-amino-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CAS 1610591-93-9) is a chemical compound with the molecular formula C25H31Cl2N5OS and a molecular weight of 520.5 g/mol. IUPAC name: 3-amino-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide. InChIKey: YEDOJNFKHXVFHD-UHFFFAOYSA-N.
| Molecular formula | C25H31Cl2N5OS |
|---|---|
| Molecular weight | 520.5 g/mol |
| IUPAC name | 3-amino-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| InChIKey | YEDOJNFKHXVFHD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=C(S2)C(=O)NCCCCCN3CCN(CC3)C4=C(C(=CC=C4)Cl)Cl)N)C |
Computed by PubChem (NCBI)