CAS 1373409-08-5 appears in our catalog under these names: EML4-ALK kinase inhibitor 1/ 99.14% (existing batch purity), EML4-ALK kinase inhibitor 1, EML4-ALK kinase inhibitor 1, 98.02%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
6-ethyl-5-[(4-methoxycyclohexyl)amino]-3-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrazine-2-carboxamide (CAS 1373409-08-5) is a chemical compound with the molecular formula C31H48N8O3 and a molecular weight of 580.8 g/mol. IUPAC name: 6-ethyl-5-[(4-methoxycyclohexyl)amino]-3-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrazine-2-carboxamide. InChIKey: KBHZCRDGGWIHQF-UHFFFAOYSA-N.
| Molecular formula | C31H48N8O3 |
|---|---|
| Molecular weight | 580.8 g/mol |
| IUPAC name | 6-ethyl-5-[(4-methoxycyclohexyl)amino]-3-[3-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]pyrazine-2-carboxamide |
| InChIKey | KBHZCRDGGWIHQF-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(C(=N1)C(=O)N)NC2=CC(=C(C=C2)N3CCC(CC3)N4CCN(CC4)C)OC)NC5CCC(CC5)OC |
Computed by PubChem (NCBI)