Epacadostat, 99.65%
cas: 1204669-58-8 — see every product listed under this CAS number, including other names
Epacadostat, 99.65% (CAS 1204669-58-8) is a chemical reagent available from Chemat. Available pack sizes: 200 mg, 25 mg, 10 mg, 100 mg, 500 mg, 5 mg, 2 g, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-15689-200 mg |
| cas | 1204669-58-8 |
| size | 200 mg |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 200 mg | 2037.97 Pln | |
| MedChemExpress | 25 mg | 649.42 Pln | |
| MedChemExpress | 10 mg | 505.45 Pln | |
| MedChemExpress | 100 mg | 1318.15 Pln | |
| MedChemExpress | 500 mg | 3955.94 Pln | |
| MedChemExpress | 5 mg | 361.49 Pln | |
| MedChemExpress | 2 g | 9714.50 Pln | |
| MedChemExpress | 10mM/1mL | 384.71 Pln | |
| MedChemExpress | 50 mg | 793.38 Pln | |
| MedChemExpress | 1 g | 5878.56 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.65% |
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide (CAS 1204669-58-8) is a chemical compound with the molecular formula C11H13BrFN7O4S and a molecular weight of 438.24 g/mol. IUPAC name: N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide. InChIKey: FBKMWOJEPMPVTQ-UHFFFAOYSA-N.
| Molecular formula | C11H13BrFN7O4S |
|---|---|
| Molecular weight | 438.24 g/mol |
| IUPAC name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| InChIKey | FBKMWOJEPMPVTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N=C(C2=NON=C2NCCNS(=O)(=O)N)NO)Br)F |
Computed by PubChem (NCBI)