cas: 2252334-12-4 — see every product listed under this CAS number, including other names
Epitinib (succinate) (CAS 2252334-12-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 2mg, 25mg, 50mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch135AVG-1mg |
| cas | 2252334-12-4 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 530.00 Pln | |
| Chemat | 5mg | 1245.20 Pln | |
| Chemat | 10mg | 1835.60 Pln | |
| Chemat | 2mg | 731.60 Pln | |
| Chemat | 25mg | 2901.20 Pln | |
| Chemat | 50mg | 3904.40 Pln | |
| Chemat | 100mg | 5262.80 Pln | |
| Chemat | 500mg | 10461.20 Pln |
| delivery time | 3 weeks |
|---|
Butanedioic acid;4-ethyl-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide (CAS 2252334-12-4) is a chemical compound with the molecular formula C28H32N6O6 and a molecular weight of 548.6 g/mol. IUPAC name: butanedioic acid;4-ethyl-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide. InChIKey: HISXHQFAOANCJX-UHFFFAOYSA-N.
| Molecular formula | C28H32N6O6 |
|---|---|
| Molecular weight | 548.6 g/mol |
| IUPAC name | butanedioic acid;4-ethyl-N-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide |
| InChIKey | HISXHQFAOANCJX-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C(=O)NC2=C(C=C3C(=C2)C(=NC=N3)NC4=CC=CC(=C4)C#C)OC.C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)