cas: 142557-76-4 — see every product listed under this CAS number, including other names
Ethanone,1-[4'-(trifluoromethyl)[1,1'-biphenyl]-4-yl]-, 98%, 98% (CAS 142557-76-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BSL-100mg |
| cas | 142557-76-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 482.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanone (CAS 142557-76-4) is a chemical compound with the molecular formula C15H11F3O and a molecular weight of 264.24 g/mol. IUPAC name: 1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanone. InChIKey: KUXRGLGGGFFFGQ-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O |
|---|---|
| Molecular weight | 264.24 g/mol |
| IUPAC name | 1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethanone |
| InChIKey | KUXRGLGGGFFFGQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)