cas: 204255-06-1 — see every product listed under this CAS number, including other names
Ethyl (3R,4R,5S)-4-acetamido-5-azido-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylate, 98%, 98% (CAS 204255-06-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130D6-100mg |
| cas | 204255-06-1 |
| size | 100mg |
| availability | 104.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 4542.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (3R,4R,5S)-4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate (CAS 204255-06-1) is a chemical compound with the molecular formula C16H26N4O4 and a molecular weight of 338.40 g/mol. IUPAC name: ethyl (3R,4R,5S)-4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate. InChIKey: MPTCBJSPQVJIPZ-RRFJBIMHSA-N.
| Molecular formula | C16H26N4O4 |
|---|---|
| Molecular weight | 338.40 g/mol |
| IUPAC name | ethyl (3R,4R,5S)-4-acetamido-5-azido-3-pentan-3-yloxycyclohexene-1-carboxylate |
| InChIKey | MPTCBJSPQVJIPZ-RRFJBIMHSA-N |
| SMILES | CCC(CC)O[C@@H]1C=C(C[C@@H]([C@H]1NC(=O)C)N=[N+]=[N-])C(=O)OCC |
Computed by PubChem (NCBI)