cas: 1257213-52-7 — see every product listed under this CAS number, including other names
Ethyl 1-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)cyclopropanecarboxylate, 98% (CAS 1257213-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213318-250MG |
| cas | 1257213-52-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 633.13 Pln | |
| Fluorochem | 10g | 1216.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate (CAS 1257213-52-7) is a chemical compound with the molecular formula C18H25BO4 and a molecular weight of 316.2 g/mol. IUPAC name: ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate. InChIKey: ZYSWTQGHMDIKPH-UHFFFAOYSA-N.
| Molecular formula | C18H25BO4 |
|---|---|
| Molecular weight | 316.2 g/mol |
| IUPAC name | ethyl 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclopropane-1-carboxylate |
| InChIKey | ZYSWTQGHMDIKPH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3(CC3)C(=O)OCC |
Computed by PubChem (NCBI)